CAS 943526-33-8 appears in our catalog under these names: 2H-Indol-2-one, 4-chloro-1,3-dihydro-7-methyl-, 95%, 4–chloro–7–methyl–2,3–dihydro–1H–indol–2–one, 2H-INdol-2-one, 4-chloro-1,3-dihydro-7-methyl-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
4-chloro-7-methyl-1,3-dihydroindol-2-one (CAS 943526-33-8) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 4-chloro-7-methyl-1,3-dihydroindol-2-one. InChIKey: UWAIMYDWOOZYGR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 4-chloro-7-methyl-1,3-dihydroindol-2-one |
| InChIKey | UWAIMYDWOOZYGR-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)CC(=O)N2 |
Computed by PubChem (NCBI)