Products 944278-22-2
CAS 944278-22-2 appears in our catalog under these names: (S)-2-Amino-2-(3-(tert-butyl)bicyclo[1.1.1]pentan-1-yl)acetic acid hydrochloride, 98%, (S)-2-Amino-2-(3-(tert-butyl)bicyclo[1.1.1]pentan-1-yl)acetic acid hydrochloride, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 25mg, 100mg, 250mg, 500mg.
(2S)-2-amino-2-(3-tert-butyl-1-bicyclo[1.1.1]pentanyl)acetic acid;hydrochloride (CAS 944278-22-2) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: (2S)-2-amino-2-(3-tert-butyl-1-bicyclo[1.1.1]pentanyl)acetic acid;hydrochloride. InChIKey: YNRSUKIZBZAXRK-JXFYQBDTSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-tert-butyl-1-bicyclo[1.1.1]pentanyl)acetic acid;hydrochloride |
| InChIKey | YNRSUKIZBZAXRK-JXFYQBDTSA-N |
| SMILES | CC(C)(C)C12CC(C1)(C2)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)