Products 944891-81-0
CAS 944891-81-0 is the registry number for 3-((2-Fluorophenoxy)methyl)benzoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
3-[(2-fluorophenoxy)methyl]benzoic acid (CAS 944891-81-0) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: 3-[(2-fluorophenoxy)methyl]benzoic acid. InChIKey: QTOOMHCZTBDSEB-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 3-[(2-fluorophenoxy)methyl]benzoic acid |
| InChIKey | QTOOMHCZTBDSEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=CC(=CC=C2)C(=O)O)F |
Computed by PubChem (NCBI)