CAS 944898-37-7 is the registry number for 2-(3-(Trifluoromethoxy)phenyl)acetaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[3-(trifluoromethoxy)phenyl]acetaldehyde (CAS 944898-37-7) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 2-[3-(trifluoromethoxy)phenyl]acetaldehyde. InChIKey: MVQGPRADDZTDED-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 2-[3-(trifluoromethoxy)phenyl]acetaldehyde |
| InChIKey | MVQGPRADDZTDED-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)CC=O |
Computed by PubChem (NCBI)