Products 944900-15-6
CAS 944900-15-6 appears in our catalog under these names: 1-(2-Chloro-6-(trifluoromethyl)pyridin-3-yl)ethanone, 95%, 1-(2-Chloro-6-(trifluoromethyl)pyridin-3-yl)ethan-1-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 10g, 250mg, 5g, 1g, 50mg, 0,5g.
1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]ethanone (CAS 944900-15-6) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]ethanone. InChIKey: MQKHOUONYFMNDF-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]ethanone |
| InChIKey | MQKHOUONYFMNDF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(N=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)