Products 944906-83-6

CAS 944906-83-6 appears in our catalog under these names: 2,3-Dimethoxypyridine-4-carboxylic acid, 98%, 2,3-Dimethoxyisonicotinic acid, 97%, 2,3-Dimethoxyisonicotinic acid 98%, 2,3-Dimethoxypyridine-4-carboxylic acid, 98%, 98%, 2,3-Dimethoxypyridine-4-carboxylic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100mg, 250mg.

2,3-dimethoxypyridine-4-carboxylic acid (CAS 944906-83-6) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 2,3-dimethoxypyridine-4-carboxylic acid. InChIKey: RIEXKKJOCNETIL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO4
Molecular weight183.16 g/mol
IUPAC name2,3-dimethoxypyridine-4-carboxylic acid
InChIKeyRIEXKKJOCNETIL-UHFFFAOYSA-N
SMILESCOC1=C(C=CN=C1OC)C(=O)O

Computed by PubChem (NCBI)