Products 944939-06-4
CAS 944939-06-4 is the registry number for 3-(2-Chloroacetyl)-1-(2,5-dimethylphenyl)urea. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-chloro-N-[(2,5-dimethylphenyl)carbamoyl]acetamide (CAS 944939-06-4) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: 2-chloro-N-[(2,5-dimethylphenyl)carbamoyl]acetamide. InChIKey: ZTGVDLYTWFHHHL-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 2-chloro-N-[(2,5-dimethylphenyl)carbamoyl]acetamide |
| InChIKey | ZTGVDLYTWFHHHL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NC(=O)NC(=O)CCl |
Computed by PubChem (NCBI)