Products 945215-53-2
CAS 945215-53-2 is the registry number for 3’-Deoxy-O6-methyl inosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,5S)-5-(hydroxymethyl)-2-(6-methoxypurin-9-yl)oxolan-3-ol (CAS 945215-53-2) is a chemical compound with the molecular formula C11H14N4O4 and a molecular weight of 266.25 g/mol. IUPAC name: (2R,3R,5S)-5-(hydroxymethyl)-2-(6-methoxypurin-9-yl)oxolan-3-ol. InChIKey: QKHSJWMRKTZSRT-MVKOHCKWSA-N.
| Molecular formula | C11H14N4O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | (2R,3R,5S)-5-(hydroxymethyl)-2-(6-methoxypurin-9-yl)oxolan-3-ol |
| InChIKey | QKHSJWMRKTZSRT-MVKOHCKWSA-N |
| SMILES | COC1=NC=NC2=C1N=CN2[C@H]3[C@@H](C[C@H](O3)CO)O |
Computed by PubChem (NCBI)