CAS 94541-55-6 is the registry number for Methyl 2-(4-aminophenyl)quinoline-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-(4-aminophenyl)quinoline-4-carboxylate (CAS 94541-55-6) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: methyl 2-(4-aminophenyl)quinoline-4-carboxylate. InChIKey: SLJVLRVWOJQKEM-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | methyl 2-(4-aminophenyl)quinoline-4-carboxylate |
| InChIKey | SLJVLRVWOJQKEM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC2=CC=CC=C21)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)