CAS 945423-08-5 is the registry number for 1-(2,4-Dichlorophenyl)-1,4-diazepane, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(2,4-dichlorophenyl)-1,4-diazepane (CAS 945423-08-5) is a chemical compound with the molecular formula C11H14Cl2N2 and a molecular weight of 245.14 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-1,4-diazepane. InChIKey: UCYIDMQDBSOXQG-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-1,4-diazepane |
| InChIKey | UCYIDMQDBSOXQG-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)