Products 945490-09-5
CAS 945490-09-5 appears in our catalog under these names: Tomaymycin DM, Pyrrolobenzodiazepine (PBD), Tomaymycin DM 98%, Tomaymycin DM, 98.01%, 98.01%, Tomaymycin DM, 95.73%. Offered by: GLPBio, Chemat Brand, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, on request, 1mg, 10mg, 25mg, 50mg, 25 mg, 5 mg.
(6aS)-3-hydroxy-2-methoxy-8-methylidene-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-11-one (CAS 945490-09-5) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: (6aS)-3-hydroxy-2-methoxy-8-methylidene-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-11-one. InChIKey: GXKVYHPROGIVCL-VIFPVBQESA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (6aS)-3-hydroxy-2-methoxy-8-methylidene-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| InChIKey | GXKVYHPROGIVCL-VIFPVBQESA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)N3CC(=C)C[C@H]3C=N2)O |
Computed by PubChem (NCBI)