CAS 945830-92-2 is the registry number for 6-Methoxy-3,4-dihydronaphthalen-1(2H)-one O-methyl oxime, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-N,6-dimethoxy-3,4-dihydro-2H-naphthalen-1-imine (CAS 945830-92-2) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (E)-N,6-dimethoxy-3,4-dihydro-2H-naphthalen-1-imine. InChIKey: VUWWOMAFWYFFIK-OUKQBFOZSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | (E)-N,6-dimethoxy-3,4-dihydro-2H-naphthalen-1-imine |
| InChIKey | VUWWOMAFWYFFIK-OUKQBFOZSA-N |
| SMILES | COC1=CC2=C(C=C1)/C(=N/OC)/CCC2 |
Computed by PubChem (NCBI)