CAS 946-80-5 appears in our catalog under these names: Metaraminol Impurity 10, Benzyl phenyl ether, 97% , Benzyl phenyl ether, Benzyl Phenyl Ether, >98.0%(GC), Benzyl Phenyl Ether 98%. Offered by: Chemat Brand, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: on request, 5g, 25g, 100g, 2,5g, 0,25g, 500g, 1g.
Phenoxymethylbenzene (CAS 946-80-5) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: phenoxymethylbenzene. InChIKey: BOTNYLSAWDQNEX-UHFFFAOYSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | phenoxymethylbenzene |
| InChIKey | BOTNYLSAWDQNEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC=C2 |
Computed by PubChem (NCBI)