CAS 946409-17-2 is the registry number for 2-(4-(Bromomethyl)phenyl)-5-methyl-1,3,4-oxadiazole, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
2-[4-(bromomethyl)phenyl]-5-methyl-1,3,4-oxadiazole (CAS 946409-17-2) is a chemical compound with the molecular formula C10H9BrN2O and a molecular weight of 253.09 g/mol. IUPAC name: 2-[4-(bromomethyl)phenyl]-5-methyl-1,3,4-oxadiazole. InChIKey: WVPQOCBRPIJXDK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 2-[4-(bromomethyl)phenyl]-5-methyl-1,3,4-oxadiazole |
| InChIKey | WVPQOCBRPIJXDK-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)