CAS 946409-19-4 is the registry number for 4-(5-Methyl-1,3,4-oxadiazol-2-yl)benzylamine, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]methanamine (CAS 946409-19-4) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: [4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]methanamine. InChIKey: SBNUQIHHPTZLSV-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | [4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]methanamine |
| InChIKey | SBNUQIHHPTZLSV-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)