CAS 947-60-4 is the registry number for 1,2,8-Trihydroxybenzo(7)annulen-9-one. Offered by: TRC. Available pack sizes: 100mg.
3,4,6-trihydroxybenzo[7]annulen-5-one (CAS 947-60-4) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 3,4,6-trihydroxybenzo[7]annulen-5-one. InChIKey: OLSYHLURTGEIBH-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3,4,6-trihydroxybenzo[7]annulen-5-one |
| InChIKey | OLSYHLURTGEIBH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2)O)O)C(=O)C(=C1)O |
Computed by PubChem (NCBI)