Products 947013-71-0

CAS 947013-71-0 is the registry number for 4-(5-Chloro-1-methyl-1H-benzoimidazol-2-yl)-butyric acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

4-(5-chloro-1-methylbenzimidazol-2-yl)butanoic acid (CAS 947013-71-0) is a chemical compound with the molecular formula C12H13ClN2O2 and a molecular weight of 252.69 g/mol. IUPAC name: 4-(5-chloro-1-methylbenzimidazol-2-yl)butanoic acid. InChIKey: LKRNBBIFVGBJNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13ClN2O2
Molecular weight252.69 g/mol
IUPAC name4-(5-chloro-1-methylbenzimidazol-2-yl)butanoic acid
InChIKeyLKRNBBIFVGBJNQ-UHFFFAOYSA-N
SMILESCN1C2=C(C=C(C=C2)Cl)N=C1CCCC(=O)O

Computed by PubChem (NCBI)