CAS 947013-71-0 is the registry number for 4-(5-Chloro-1-methyl-1H-benzoimidazol-2-yl)-butyric acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
4-(5-chloro-1-methylbenzimidazol-2-yl)butanoic acid (CAS 947013-71-0) is a chemical compound with the molecular formula C12H13ClN2O2 and a molecular weight of 252.69 g/mol. IUPAC name: 4-(5-chloro-1-methylbenzimidazol-2-yl)butanoic acid. InChIKey: LKRNBBIFVGBJNQ-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O2 |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | 4-(5-chloro-1-methylbenzimidazol-2-yl)butanoic acid |
| InChIKey | LKRNBBIFVGBJNQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Cl)N=C1CCCC(=O)O |
Computed by PubChem (NCBI)