Products 947162-87-0
CAS 947162-87-0 is the registry number for 6-(Hydroxymethyl)benzo[c][1,2]oxaborol-1(3H)-ol, 98%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol (CAS 947162-87-0) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: (1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol. InChIKey: SESOJWCZJGQDCJ-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | (1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol |
| InChIKey | SESOJWCZJGQDCJ-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2)CO)O |
Computed by PubChem (NCBI)