Products 948015-78-9
CAS 948015-78-9 appears in our catalog under these names: 7-Fluoro-3,4-dihydro-1h-benzo[e][1,4]diazepine-2,5-dione, 95%, 7-Fluoro-3,4-dihydro-1H-benzo(e)(1,4)diazepine-2,5-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
7-fluoro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (CAS 948015-78-9) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: 7-fluoro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione. InChIKey: JJYBYHOJUUPWGN-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | 7-fluoro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| InChIKey | JJYBYHOJUUPWGN-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)F)C(=O)N1 |
Computed by PubChem (NCBI)