Products 948291-17-6
CAS 948291-17-6 appears in our catalog under these names: 7-Methylquinoline-3-carboxylic acid, 95%, 7-Methylquinoline-3-carboxylic acid, 98%, 7-Methylquinoline-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 2,5g.
7-methylquinoline-3-carboxylic acid (CAS 948291-17-6) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 7-methylquinoline-3-carboxylic acid. InChIKey: QJHXTZODJCAGBE-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 7-methylquinoline-3-carboxylic acid |
| InChIKey | QJHXTZODJCAGBE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=C(C=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
7-Methylquinoline-3-carboxylic acid