CAS 948292-48-6 is the registry number for ETHYL 3-(4-BROMOPHENYL)-1H-PYRAZOLE-5-CARBOXYLATE, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 3-(4-bromophenyl)-1H-pyrazole-5-carboxylate (CAS 948292-48-6) is a chemical compound with the molecular formula C12H11BrN2O2 and a molecular weight of 295.13 g/mol. IUPAC name: ethyl 3-(4-bromophenyl)-1H-pyrazole-5-carboxylate. InChIKey: VCEOMTVGHVZJDJ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O2 |
|---|---|
| Molecular weight | 295.13 g/mol |
| IUPAC name | ethyl 3-(4-bromophenyl)-1H-pyrazole-5-carboxylate |
| InChIKey | VCEOMTVGHVZJDJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)