Products 948292-93-1
CAS 948292-93-1 appears in our catalog under these names: 1-Benzyl-3-phenyl-1H-pyrazole-5-carboxylic acid, 1-Benzyl-3-phenyl-1H-pyrazole-5-carboxylic acid, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 250mg, 500mg, 1000mg, 1g.
1-benzyl-3-phenylpyrazole-5-carboxylic acid (CAS 948292-93-1) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: 1-benzyl-3-phenylpyrazole-5-carboxylic acid. InChIKey: BKKZEKMUTJMNQZ-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-benzyl-3-phenylpyrazole-5-carboxylic acid |
| InChIKey | BKKZEKMUTJMNQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=CC(=N2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)