Products 94884-92-1
CAS 94884-92-1 is the registry number for 8-Methoxynaringenin. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,7-dihydroxy-2-(4-hydroxyphenyl)-8-methoxy-2,3-dihydrochromen-4-one (CAS 94884-92-1) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-methoxy-2,3-dihydrochromen-4-one. InChIKey: OJCCBPWPNVUJFG-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-methoxy-2,3-dihydrochromen-4-one |
| InChIKey | OJCCBPWPNVUJFG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C2=C1OC(CC2=O)C3=CC=C(C=C3)O)O)O |
Computed by PubChem (NCBI)