Products 94942-49-1
CAS 94942-49-1 appears in our catalog under these names: 6-Methoxynaringenin, 6-Methoxynaringenin/ 97.87% (existing batch purity). Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 25mg, 1mg, Get quote.
5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-2,3-dihydrochromen-4-one (CAS 94942-49-1) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-2,3-dihydrochromen-4-one. InChIKey: FCXRFTLSXMRXTM-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-2,3-dihydrochromen-4-one |
| InChIKey | FCXRFTLSXMRXTM-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1O)OC(CC2=O)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)