Products 950781-87-0
CAS 950781-87-0 appears in our catalog under these names: Varenicline Impurity 10, Varenicline Impurity 5, Varenicline Impurity 20. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-nitro-10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-4-amine (CAS 950781-87-0) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 5-nitro-10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-4-amine. InChIKey: UWGRPOMNPQPMCS-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 5-nitro-10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-4-amine |
| InChIKey | UWGRPOMNPQPMCS-UHFFFAOYSA-N |
| SMILES | C1C2CNCC1C3=CC(=C(C=C23)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)