CAS 950858-26-1 appears in our catalog under these names: 8-Amino-10-methyldibenzo(b,f)(1,4)thiazepin-11(10H)-one, 95+%, 6-Amino-9-methyl-2-thia-9-azatricyclo(9.4.0.0,3,8)pentadeca-1(15),3,5,7,11,13-hexaen-10-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-amino-5-methylbenzo[b][1,4]benzothiazepin-6-one (CAS 950858-26-1) is a chemical compound with the molecular formula C14H12N2OS and a molecular weight of 256.32 g/mol. IUPAC name: 3-amino-5-methylbenzo[b][1,4]benzothiazepin-6-one. InChIKey: BLBPXSIZTSBHJY-UHFFFAOYSA-N.
| Molecular formula | C14H12N2OS |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | 3-amino-5-methylbenzo[b][1,4]benzothiazepin-6-one |
| InChIKey | BLBPXSIZTSBHJY-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)N)SC3=CC=CC=C3C1=O |
Computed by PubChem (NCBI)