Products 951-81-5

CAS 951-81-5 is the registry number for 2-Chloro-4'-nitro-biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-chloro-2-(4-nitrophenyl)benzene (CAS 951-81-5) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 1-chloro-2-(4-nitrophenyl)benzene. InChIKey: UEUOHXXNBGWCBX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8ClNO2
Molecular weight233.65 g/mol
IUPAC name1-chloro-2-(4-nitrophenyl)benzene
InChIKeyUEUOHXXNBGWCBX-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC=C(C=C2)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)