Products 951122-37-5
CAS 951122-37-5 appears in our catalog under these names: 2,6-Difluoro-3-hydroxybenzamide, 95%, 2,6-Difluoro-3-hydroxybenzamide 95%, 2,6-Difluoro-3-hydroxybenzamide, 98%, 98%, 2,6-Difluoro-3-hydroxybenzamide, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
2,6-difluoro-3-hydroxybenzamide (CAS 951122-37-5) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 2,6-difluoro-3-hydroxybenzamide. InChIKey: ZZNIADKIUCGMNN-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 2,6-difluoro-3-hydroxybenzamide |
| InChIKey | ZZNIADKIUCGMNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)F)C(=O)N)F |
Computed by PubChem (NCBI)