CAS 951971-87-2 is the registry number for YU185530. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3,4-dihydroxyphenyl)-3,7,7-trimethyl-4,6,8,9-tetrahydro-[1,2]oxazolo[5,4-b]quinolin-5-one (CAS 951971-87-2) is a chemical compound with the molecular formula C19H20N2O4 and a molecular weight of 340.4 g/mol. IUPAC name: 4-(3,4-dihydroxyphenyl)-3,7,7-trimethyl-4,6,8,9-tetrahydro-[1,2]oxazolo[5,4-b]quinolin-5-one. InChIKey: GZCADSFCBVFOED-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 4-(3,4-dihydroxyphenyl)-3,7,7-trimethyl-4,6,8,9-tetrahydro-[1,2]oxazolo[5,4-b]quinolin-5-one |
| InChIKey | GZCADSFCBVFOED-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(C3=C(N2)CC(CC3=O)(C)C)C4=CC(=C(C=C4)O)O |
Computed by PubChem (NCBI)