CAS 952949-06-3 is the registry number for 4-Chloro-1,2-dihydro-5-acenaphthylenamine. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
4-chloro-1,2-dihydroacenaphthylen-5-amine (CAS 952949-06-3) is a chemical compound with the molecular formula C12H10ClN and a molecular weight of 203.67 g/mol. IUPAC name: 4-chloro-1,2-dihydroacenaphthylen-5-amine. InChIKey: YPTASRYZXOUVPZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 4-chloro-1,2-dihydroacenaphthylen-5-amine |
| InChIKey | YPTASRYZXOUVPZ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C3=CC=CC1=C23)N)Cl |
Computed by PubChem (NCBI)