CAS 953-26-4 appears in our catalog under these names: Ethyl 4–Nitrocinnamate, Ethyl 4-nitrocinnamate, Ethyl 4-nitrocinnamate, 95%, Ethyl 4-nitrocinnamate 95% (E), Ethyl 4-nitrocinnamate, 95% (E), 95% (E). Offered by: GLPBio, Biosynth, Fluorochem, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1000g, 500g, 2000g, 5000g, 1g.
Ethyl 3-(4-nitrophenyl)prop-2-enoate (CAS 953-26-4) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: ethyl 3-(4-nitrophenyl)prop-2-enoate. InChIKey: PFBQVGXIMLXCQB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | ethyl 3-(4-nitrophenyl)prop-2-enoate |
| InChIKey | PFBQVGXIMLXCQB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=CC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)