Products 953750-12-4
CAS 953750-12-4 appears in our catalog under these names: 3-(3-Ethoxy-4-hydroxyphenyl)-2-oxopropanoic acid, 98%, 3-(3-Ethoxy-4-hydroxyphenyl)-2-oxopropanoic Acid, >95%, >95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
3-(3-ethoxy-4-hydroxyphenyl)-2-oxopropanoic acid (CAS 953750-12-4) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: 3-(3-ethoxy-4-hydroxyphenyl)-2-oxopropanoic acid. InChIKey: RKILNZQPMQIQTL-UHFFFAOYSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 3-(3-ethoxy-4-hydroxyphenyl)-2-oxopropanoic acid |
| InChIKey | RKILNZQPMQIQTL-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)CC(=O)C(=O)O)O |
Computed by PubChem (NCBI)