Products 953751-20-7
CAS 953751-20-7 is the registry number for 1-(5-Chloropyridin-2-yl)piperidine-4-carboxylic acid, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(5-chloro-2-pyridinyl)piperidine-4-carboxylic acid (CAS 953751-20-7) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: 1-(5-chloro-2-pyridinyl)piperidine-4-carboxylic acid. InChIKey: YOSRZAOSDZTMAM-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 1-(5-chloro-2-pyridinyl)piperidine-4-carboxylic acid |
| InChIKey | YOSRZAOSDZTMAM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)