Products 953888-49-8
CAS 953888-49-8 appears in our catalog under these names: 3-Amino-4-methoxy-N,N-dimethylbenzamide, 95%, 3-Amino-4-methoxy-N,N-dimethyl-benzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g.
3-amino-4-methoxy-N,N-dimethylbenzamide (CAS 953888-49-8) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 3-amino-4-methoxy-N,N-dimethylbenzamide. InChIKey: SJKKMKJDUYNDNW-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-amino-4-methoxy-N,N-dimethylbenzamide |
| InChIKey | SJKKMKJDUYNDNW-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)OC)N |
Computed by PubChem (NCBI)