CAS 954-91-6 is the registry number for 2-Phenyl-2,3-dihydroquinazolin-4(1H)-one. Offered by: Biosynth. Available pack sizes: 50mg.
2-phenyl-2,3-dihydro-1H-quinazolin-4-one (CAS 954-91-6) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 2-phenyl-2,3-dihydro-1H-quinazolin-4-one. InChIKey: BIVGFFFLVZMILM-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-phenyl-2,3-dihydro-1H-quinazolin-4-one |
| InChIKey | BIVGFFFLVZMILM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2NC3=CC=CC=C3C(=O)N2 |
Computed by PubChem (NCBI)