CAS 954124-23-3 is the registry number for 4-(4-Aminophenyl)piperidine-2,6-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(4-aminophenyl)piperidine-2,6-dione (CAS 954124-23-3) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 4-(4-aminophenyl)piperidine-2,6-dione. InChIKey: LZIUHZARISAQQQ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 4-(4-aminophenyl)piperidine-2,6-dione |
| InChIKey | LZIUHZARISAQQQ-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)NC1=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)