CAS 954263-48-0 is the registry number for 5-Nitro-2-(2,2,2-trifluoroethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-nitro-2-(2,2,2-trifluoroethoxy)benzoic acid (CAS 954263-48-0) is a chemical compound with the molecular formula C9H6F3NO5 and a molecular weight of 265.14 g/mol. IUPAC name: 5-nitro-2-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: OPNWZBDKQMKXHV-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO5 |
|---|---|
| Molecular weight | 265.14 g/mol |
| IUPAC name | 5-nitro-2-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | OPNWZBDKQMKXHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)OCC(F)(F)F |
Computed by PubChem (NCBI)