Products 728-54-1
CAS 728-54-1 is the registry number for methyl 3-nitro-4-(trifluoromethoxy)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Methyl 3-nitro-4-(trifluoromethoxy)benzoate (CAS 728-54-1) is a chemical compound with the molecular formula C9H6F3NO5 and a molecular weight of 265.14 g/mol. IUPAC name: methyl 3-nitro-4-(trifluoromethoxy)benzoate. InChIKey: QDKSJOXKTZEEHQ-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO5 |
|---|---|
| Molecular weight | 265.14 g/mol |
| IUPAC name | methyl 3-nitro-4-(trifluoromethoxy)benzoate |
| InChIKey | QDKSJOXKTZEEHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)OC(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)