Products 113405-09-7
CAS 113405-09-7 is the registry number for (4-Nitro-3-trifluoromethyl-phenoxy)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[4-nitro-3-(trifluoromethyl)phenoxy]acetic acid (CAS 113405-09-7) is a chemical compound with the molecular formula C9H6F3NO5 and a molecular weight of 265.14 g/mol. IUPAC name: 2-[4-nitro-3-(trifluoromethyl)phenoxy]acetic acid. InChIKey: FMMDNTXLWDHKSS-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO5 |
|---|---|
| Molecular weight | 265.14 g/mol |
| IUPAC name | 2-[4-nitro-3-(trifluoromethyl)phenoxy]acetic acid |
| InChIKey | FMMDNTXLWDHKSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(=O)O)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-[4-nitro-3-(trifluoromethyl)phenoxy]acetic acid, Acetic acid, [4-nitro-3-(trifluoromethyl)phenoxy]-, (4-Nitro-3-trifluoromethyl-phenoxy)-acetic acid, [4-Nitro-3-(trifluoromethyl)phenoxy]acetic acid, 4-nitro-3-trifluoromethylphenoxyacetic acid, Acetic acid, 2-[4-nitro-3-(trifluoromethyl)phenoxy]-