CAS 40005-15-0 is the registry number for 4-Nitrophenyl 2,2,2-trifluoroethyl carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4-nitrophenyl) 2,2,2-trifluoroethyl carbonate (CAS 40005-15-0) is a chemical compound with the molecular formula C9H6F3NO5 and a molecular weight of 265.14 g/mol. IUPAC name: (4-nitrophenyl) 2,2,2-trifluoroethyl carbonate. InChIKey: BLJJFFADYSFMGJ-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO5 |
|---|---|
| Molecular weight | 265.14 g/mol |
| IUPAC name | (4-nitrophenyl) 2,2,2-trifluoroethyl carbonate |
| InChIKey | BLJJFFADYSFMGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)