CAS 954580-07-5 is the registry number for 2-Nitro-5-(2,2,2-trifluoroethoxy)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-nitro-5-(2,2,2-trifluoroethoxy)benzoic acid (CAS 954580-07-5) is a chemical compound with the molecular formula C9H6F3NO5 and a molecular weight of 265.14 g/mol. IUPAC name: 2-nitro-5-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: QSHUFKNNGQXTTA-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO5 |
|---|---|
| Molecular weight | 265.14 g/mol |
| IUPAC name | 2-nitro-5-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | QSHUFKNNGQXTTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(F)(F)F)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)