CAS 954566-80-4 appears in our catalog under these names: 2-(4-(3,3-Dimethylbutanamido)phenyl)acetic acid, 2-(4-(3,3-Dimethylbutanamido)phenyl)acetic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
2-[4-(3,3-dimethylbutanoylamino)phenyl]acetic acid (CAS 954566-80-4) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: 2-[4-(3,3-dimethylbutanoylamino)phenyl]acetic acid. InChIKey: MTDFRKQOCOBRRK-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | 2-[4-(3,3-dimethylbutanoylamino)phenyl]acetic acid |
| InChIKey | MTDFRKQOCOBRRK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)NC1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)