Products 955328-22-0
CAS 955328-22-0 appears in our catalog under these names: 4-Amino-8-chloroquinoline-3-carboxylic acid, 95%, 4-Amino-8-chloroquinoline-3-carboxylic Acid, FTO-IN-12, 97%, FTO-IN-12. Offered by: Combi-blocks, TRC, AmBeed, MedChemExpress. Available pack sizes: 10g, 5g, 1g, 250mg, Get quote.
4-amino-8-chloroquinoline-3-carboxylic acid (CAS 955328-22-0) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: 4-amino-8-chloroquinoline-3-carboxylic acid. InChIKey: DMQKTDVVSMSBCL-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 4-amino-8-chloroquinoline-3-carboxylic acid |
| InChIKey | DMQKTDVVSMSBCL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C(=C1)Cl)C(=O)O)N |
Computed by PubChem (NCBI)