CAS 95579-00-3 is the registry number for rac-Tryptophan EP Impurity G HCl. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid hydrochloride is a hydrochloride obtained by reaction of 2-amino-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid with one equivalent of hydrochloric acid. It contains a 2-amino-3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid.
Source: ChEBI
| Molecular formula | C11H13ClN2O3 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 2-amino-3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid;hydrochloride |
| InChIKey | ZYBLLQBDSSXXLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(=O)N2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)