Products 955961-59-8
CAS 955961-59-8 is the registry number for 2-{((3-Chlorophenyl)carbamoyl)amino}-3-methylbutanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-[(3-chlorophenyl)carbamoylamino]-3-methylbutanoic acid (CAS 955961-59-8) is a chemical compound with the molecular formula C12H15ClN2O3 and a molecular weight of 270.71 g/mol. IUPAC name: 2-[(3-chlorophenyl)carbamoylamino]-3-methylbutanoic acid. InChIKey: XULPKQAQFXKSRR-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O3 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 2-[(3-chlorophenyl)carbamoylamino]-3-methylbutanoic acid |
| InChIKey | XULPKQAQFXKSRR-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NC(=O)NC1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)