CAS 956-07-0 is the registry number for Azelastine Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.
N-(benzylideneamino)benzamide (CAS 956-07-0) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: N-(benzylideneamino)benzamide. InChIKey: RISHSDLMXPLIHT-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | N-(benzylideneamino)benzamide |
| InChIKey | RISHSDLMXPLIHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NNC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)