Products 956218-04-5
CAS 956218-04-5 appears in our catalog under these names: 2-Bromo-4-cyanobenzoic acid, 96%, 2-Bromo-4-cyanobenzoic acid 97%, 2-Bromo-4-cyanobenzoic acid, 97%, 97%, 2-Bromo-4-cyanobenzoic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g.
2-bromo-4-cyanobenzoic acid (CAS 956218-04-5) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 2-bromo-4-cyanobenzoic acid. InChIKey: HAPUQRLIPJWXBH-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 2-bromo-4-cyanobenzoic acid |
| InChIKey | HAPUQRLIPJWXBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)Br)C(=O)O |
Computed by PubChem (NCBI)