CAS 58123-69-6 appears in our catalog under these names: 3-Bromo-4-cyanobenzoic acid, 96%, 3–Bromo–4–cyanobenzoic Acid, 3-Bromo-4-cyanobenzoic acid 98%, 3-Bromo-4-cyanobenzoic Acid, 98%, 98%, 3-Bromo-4-cyanobenzoic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
3-bromo-4-cyanobenzoic acid (CAS 58123-69-6) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 3-bromo-4-cyanobenzoic acid. InChIKey: WAFUFPLTXVDCNT-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 3-bromo-4-cyanobenzoic acid |
| InChIKey | WAFUFPLTXVDCNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)C#N |
Computed by PubChem (NCBI)