Products 453566-14-8
CAS 453566-14-8 appears in our catalog under these names: 3-Bromo-5-cyanobenzoic acid, 97%, 3–Bromo–5–cyanobenzoic Acid, 3-Bromo-5-cyanobenzoic acid, 3-Bromo-5-cyanobenzoic acid 97%, Benzoic acid, 3-bromo-5-cyano-, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg, 1000mg, 2000mg.
3-bromo-5-cyanobenzoic acid (CAS 453566-14-8) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 3-bromo-5-cyanobenzoic acid. InChIKey: QJJKUQVSSJSXLJ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 3-bromo-5-cyanobenzoic acid |
| InChIKey | QJJKUQVSSJSXLJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)Br)C#N |
Computed by PubChem (NCBI)