CAS 6120-26-9 appears in our catalog under these names: 6-Bromo-1,3-benzodioxole-5-carbonitrile, 95%, 6-Bromobenzo[d][1,3]dioxole-5-carbonitrile, 97%, 97%, 6-Bromobenzo[d][1,3]dioxole-5-carbonitrile, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
6-bromo-1,3-benzodioxole-5-carbonitrile (CAS 6120-26-9) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 6-bromo-1,3-benzodioxole-5-carbonitrile. InChIKey: YJAZLOORQHTWFN-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 6-bromo-1,3-benzodioxole-5-carbonitrile |
| InChIKey | YJAZLOORQHTWFN-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C#N)Br |
Computed by PubChem (NCBI)